C20H14N4O10 — CID 141163009
1,4-bis(2,4-dinitrophenoxy)-2,3-dimethylbenzene (PubChem CID 141163009) has the molecular formula C20H14N4O10 and a molecular weight of 470.35 g/mol. Its IUPAC name is 1,4-bis(2,4-dinitrophenoxy)-2,3-dimethylbenzene.
| Compound Name | 1,4-bis(2,4-dinitrophenoxy)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 141163009 |
| Molecular Formula | C20H14N4O10 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1,4-bis(2,4-dinitrophenoxy)-2,3-dimethylbenzene |
| SMILES | Cc1c(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H14N4O10/c1-11-12(2)18(34-20-6-4-14(22(27)28)10-16(20)24(31)32)8-7-17(11)33-19-5-3-13(21(25)26)9-15(19)23(29)30/h3-10H,1-2H3 |
| InChIKey | KGBZTNRNHXCVLI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|