C13H9ClN2O5 — CID 9111258
1-chloro-2-(2,4-dinitrophenoxy)-4-methylbenzene (PubChem CID 9111258) has the molecular formula C13H9ClN2O5 and a molecular weight of 308.68 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dinitrophenoxy)-4-methylbenzene.
| Compound Name | 1-chloro-2-(2,4-dinitrophenoxy)-4-methylbenzene |
|---|---|
| PubChem CID | 9111258 |
| Molecular Formula | C13H9ClN2O5 |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-chloro-2-(2,4-dinitrophenoxy)-4-methylbenzene |
| SMILES | Cc1ccc(Cl)c(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9ClN2O5/c1-8-2-4-10(14)13(6-8)21-12-5-3-9(15(17)18)7-11(12)16(19)20/h2-7H,1H3 |
| InChIKey | OINGRSXELXBHSW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|