C20H14ClN3O5 — CID 126218432
1-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-N-(4-methylphenyl)methanimine (PubChem CID 126218432) has the molecular formula C20H14ClN3O5 and a molecular weight of 411.80 g/mol. Its IUPAC name is 1-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126218432 |
| Molecular Formula | C20H14ClN3O5 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[5-chloro-2-(2,4-dinitrophenoxy)phenyl]-N-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc(Cl)ccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14ClN3O5/c1-13-2-5-16(6-3-13)22-12-14-10-15(21)4-8-19(14)29-20-9-7-17(23(25)26)11-18(20)24(27)28/h2-12H,1H3/b22-12+ |
| InChIKey | OTFBJBLYHUJBAV-WSDLNYQXSA-N |
| XLogP | 6.01 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|