C21H17N3O6 — CID 126215266
1-[2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 126215266) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is 1-[2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126215266 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[2-(2,4-dinitrophenoxy)phenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2ccccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N3O6/c1-2-29-18-10-7-16(8-11-18)22-14-15-5-3-4-6-20(15)30-21-12-9-17(23(25)26)13-19(21)24(27)28/h3-14H,2H2,1H3/b22-14+ |
| InChIKey | FLULWFDAQWVZKU-HYARGMPZSA-N |
| XLogP | 5.44 |
| TPSA | 117.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|