C22H18IN3O7 — CID 126219437
1-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]-N-(4-methoxyphenyl)methanimine (PubChem CID 126219437) has the molecular formula C22H18IN3O7 and a molecular weight of 563.30 g/mol. Its IUPAC name is 1-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]-N-(4-methoxyphenyl)methanimine.
| Compound Name | 1-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]-N-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126219437 |
| Molecular Formula | C22H18IN3O7 |
| Molecular Weight | 563.30 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | 1-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-iodophenyl]-N-(4-methoxyphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(OC)cc2)cc(I)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18IN3O7/c1-3-32-21-11-14(13-24-15-4-7-17(31-2)8-5-15)10-18(23)22(21)33-20-9-6-16(25(27)28)12-19(20)26(29)30/h4-13H,3H2,1-2H3/b24-13+ |
| InChIKey | TWWZLIBGLOPCRH-ZMOGYAJESA-N |
| XLogP | 6.06 |
| TPSA | 126.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.30 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|