C23H18BrF3N2O5 — CID 126223316
1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 126223316) has the molecular formula C23H18BrF3N2O5 and a molecular weight of 539.30 g/mol. Its IUPAC name is 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethoxyphenyl)methanimine.
| Compound Name | 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126223316 |
| Molecular Formula | C23H18BrF3N2O5 |
| Molecular Weight | 539.30 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2cc(Br)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C23H18BrF3N2O5/c1-3-33-17-7-5-16(6-8-17)28-13-14-10-18(24)22(21(11-14)32-2)34-20-9-4-15(23(25,26)27)12-19(20)29(30)31/h4-13H,3H2,1-2H3/b28-13+ |
| InChIKey | RXIUPACKPQNUAS-XODNFHPESA-N |
| XLogP | 7.33 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.30 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|