About 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine
1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine (PubChem CID 126216955) has the molecular formula C22H18IN3O7
and a molecular weight of 563.30 g/mol. Its IUPAC name is 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine.
Molecular Properties
| Compound Name | 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine |
| PubChem CID | 126216955 |
| Molecular Formula | C22H18IN3O7 |
| Molecular Weight | 563.30 g/mol |
| Exact Mass | 563.02 |
| IUPAC Name | 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/N=C/c2cc(I)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C22H18IN3O7/c1-3-32-17-7-4-15(5-8-17)24-13-14-10-18(23)22(21(11-14)31-2)33-20-9-6-16(25(27)28)12-19(20)26(29)30/h4-13H,3H2,1-2H3/b24-13+ |
| InChIKey | MHLJICHKDZHOGD-ZMOGYAJESA-N |
| XLogP | 6.06 |
| TPSA | 126.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.30 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine?
The IUPAC name of 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine (CID 126216955) is 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine.
What is the SMILES notation for 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine?
The canonical SMILES for 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine is CCOc1ccc(/N=C/c2cc(I)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)cc1.
What is the InChIKey of 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine?
The InChIKey is MHLJICHKDZHOGD-ZMOGYAJESA-N. The full InChI is InChI=1S/C22H18IN3O7/c1-3-32-17-7-4-15(5-8-17)24-13-14-10-18(23)22(21(11-14)31-2)33-20-9-6-16(25(27)28)12-19(20)26(29)30/h4-13H,3H2,1-2H3/b24-13+.
What are the key properties of 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine?
1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine has a molecular weight of 563.30 g/mol, XLogP of 6.06, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-ethoxyphenyl)methanimine is sourced from PubChem (CID 126216955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).