C22H19N3O8 — CID 35269252
1-[4-(2,4-dinitrophenoxy)phenyl]-N-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 35269252) has the molecular formula C22H19N3O8 and a molecular weight of 453.41 g/mol. Its IUPAC name is 1-[4-(2,4-dinitrophenoxy)phenyl]-N-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | 1-[4-(2,4-dinitrophenoxy)phenyl]-N-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 35269252 |
| Molecular Formula | C22H19N3O8 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 1-[4-(2,4-dinitrophenoxy)phenyl]-N-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H19N3O8/c1-30-20-10-15(11-21(31-2)22(20)32-3)23-13-14-4-7-17(8-5-14)33-19-9-6-16(24(26)27)12-18(19)25(28)29/h4-13H,1-3H3/b23-13+ |
| InChIKey | YMVJVMMYERJCFF-YDZHTSKRSA-N |
| XLogP | 5.07 |
| TPSA | 135.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|