C14H10IN3O7 — CID 126091675
(NZ)-N-[[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]methylidene]hydroxylamine (PubChem CID 126091675) has the molecular formula C14H10IN3O7 and a molecular weight of 459.15 g/mol. Its IUPAC name is (NZ)-N-[[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 126091675 |
| Molecular Formula | C14H10IN3O7 |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | (NZ)-N-[[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(/C=N\O)cc(I)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10IN3O7/c1-24-13-5-8(7-16-19)4-10(15)14(13)25-12-3-2-9(17(20)21)6-11(12)18(22)23/h2-7,19H,1H3/b16-7- |
| InChIKey | ODZDCYOXGARZOQ-APSNUPSMSA-N |
| XLogP | 3.72 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|