C14H11BrN2O7 — CID 126128858
[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methanol (PubChem CID 126128858) has the molecular formula C14H11BrN2O7 and a molecular weight of 399.15 g/mol. Its IUPAC name is [3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methanol.
| Compound Name | [3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 126128858 |
| Molecular Formula | C14H11BrN2O7 |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | [3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11BrN2O7/c1-23-13-5-8(7-18)4-10(15)14(13)24-12-3-2-9(16(19)20)6-11(12)17(21)22/h2-6,18H,7H2,1H3 |
| InChIKey | ZKSLLBSMDVKJAJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|