C24H20Br2N4O8 — CID 126339251
N-[(E)-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide (PubChem CID 126339251) has the molecular formula C24H20Br2N4O8 and a molecular weight of 652.25 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 126339251 |
| Molecular Formula | C24H20Br2N4O8 |
| Molecular Weight | 652.25 g/mol |
| Exact Mass | 649.96 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-3-methoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Br)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)cc1OC |
| InChI | InChI=1S/C24H20Br2N4O8/c1-3-8-37-21-6-4-15(11-22(21)36-2)24(31)28-27-13-14-9-17(25)23(18(26)10-14)38-20-7-5-16(29(32)33)12-19(20)30(34)35/h4-7,9-13H,3,8H2,1-2H3,(H,28,31)/b27-13+ |
| InChIKey | ITPKDWBJKFLZLO-UVHMKAGCSA-N |
| XLogP | 6.38 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.25 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|