C25H23ClN4O9 — CID 126319671
N-[(E)-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126319671) has the molecular formula C25H23ClN4O9 and a molecular weight of 558.93 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126319671 |
| Molecular Formula | C25H23ClN4O9 |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[(E)-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OCC)c2)cc1OC |
| InChI | InChI=1S/C25H23ClN4O9/c1-4-37-21-8-6-16(12-22(21)36-3)25(31)28-27-14-15-10-18(26)24(23(11-15)38-5-2)39-20-9-7-17(29(32)33)13-19(20)30(34)35/h6-14H,4-5H2,1-3H3,(H,28,31)/b27-14+ |
| InChIKey | BYHNBBTWPLYGNH-MZJWZYIUSA-N |
| XLogP | 5.52 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|