C26H21ClF3N3O7 — CID 126332267
N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126332267) has the molecular formula C26H21ClF3N3O7 and a molecular weight of 579.92 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126332267 |
| Molecular Formula | C26H21ClF3N3O7 |
| Molecular Weight | 579.92 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H21ClF3N3O7/c1-4-9-39-21-7-5-16(12-22(21)37-2)25(34)32-31-14-15-10-18(27)24(23(11-15)38-3)40-20-8-6-17(26(28,29)30)13-19(20)33(35)36/h4-8,10-14H,1,9H2,2-3H3,(H,32,34)/b31-14+ |
| InChIKey | GZLYECPRYQHYEU-XAZZYMPDSA-N |
| XLogP | 6.41 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.92 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|