C25H20F3N3O6 — CID 126311892
3-methoxy-N-[(E)-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide (PubChem CID 126311892) has the molecular formula C25H20F3N3O6 and a molecular weight of 515.44 g/mol. Its IUPAC name is 3-methoxy-N-[(E)-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide.
| Compound Name | 3-methoxy-N-[(E)-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126311892 |
| Molecular Formula | C25H20F3N3O6 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 3-methoxy-N-[(E)-[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H20F3N3O6/c1-3-12-36-22-10-8-16(13-23(22)35-2)24(32)30-29-15-17-6-4-5-7-20(17)37-21-11-9-18(25(26,27)28)14-19(21)31(33)34/h3-11,13-15H,1,12H2,2H3,(H,30,32)/b29-15+ |
| InChIKey | XDWWWQGLMUGASX-WKULSOCRSA-N |
| XLogP | 5.74 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|