C25H21ClF3N3O7 — CID 126327582
N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide (PubChem CID 126327582) has the molecular formula C25H21ClF3N3O7 and a molecular weight of 567.90 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 126327582 |
| Molecular Formula | C25H21ClF3N3O7 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H21ClF3N3O7/c1-4-38-20-7-5-15(11-21(20)36-2)24(33)31-30-13-14-9-17(26)23(22(10-14)37-3)39-19-8-6-16(25(27,28)29)12-18(19)32(34)35/h5-13H,4H2,1-3H3,(H,31,33)/b30-13+ |
| InChIKey | GJJFBWWQWITCQR-VVEOGCPPSA-N |
| XLogP | 6.24 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|