C23H18F3N3O6 — CID 126332450
3,4-dimethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]benzamide (PubChem CID 126332450) has the molecular formula C23H18F3N3O6 and a molecular weight of 489.41 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126332450 |
| Molecular Formula | C23H18F3N3O6 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 3,4-dimethoxy-N-[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C23H18F3N3O6/c1-33-20-8-6-15(11-21(20)34-2)22(30)28-27-13-14-4-3-5-17(10-14)35-19-9-7-16(23(24,25)26)12-18(19)29(31)32/h3-13H,1-2H3,(H,28,30)/b27-13+ |
| InChIKey | JPQRSXBLANHUOV-UVHMKAGCSA-N |
| XLogP | 5.19 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|