C15H11F3N4O4 — CID 56726663
[(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]urea (PubChem CID 56726663) has the molecular formula C15H11F3N4O4 and a molecular weight of 368.27 g/mol. Its IUPAC name is [(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]urea.
| Compound Name | [(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 56726663 |
| Molecular Formula | C15H11F3N4O4 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [(E)-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1cccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11F3N4O4/c16-15(17,18)10-4-5-13(12(7-10)22(24)25)26-11-3-1-2-9(6-11)8-20-21-14(19)23/h1-8H,(H3,19,21,23)/b20-8+ |
| InChIKey | SPNFTEAPZVXZNV-DNTJNYDQSA-N |
| XLogP | 3.41 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|