C17H9F10N3O3 — CID 126044338
1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]propan-1-amine (PubChem CID 126044338) has the molecular formula C17H9F10N3O3 and a molecular weight of 493.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126044338 |
| Molecular Formula | C17H9F10N3O3 |
| Molecular Weight | 493.26 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]propan-1-amine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Oc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H9F10N3O3/c18-14(19,20)10-3-6-13(12(7-10)30(31)32)33-11-4-1-9(2-5-11)8-28-29-17(26,27)15(21,22)16(23,24)25/h1-8,29H/b28-8+ |
| InChIKey | ODXDOJMXMDNSOV-YLKCYHHESA-N |
| XLogP | 6.12 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.26 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|