C11H8F7N3O4 — CID 137174117
4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2-methoxy-6-nitrophenol (PubChem CID 137174117) has the molecular formula C11H8F7N3O4 and a molecular weight of 379.19 g/mol. Its IUPAC name is 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2-methoxy-6-nitrophenol.
| Compound Name | 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 137174117 |
| Molecular Formula | C11H8F7N3O4 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-[(E)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-2-methoxy-6-nitrophenol |
| SMILES | COc1cc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C11H8F7N3O4/c1-25-7-3-5(2-6(8(7)22)21(23)24)4-19-20-11(17,18)9(12,13)10(14,15)16/h2-4,20,22H,1H3/b19-4+ |
| InChIKey | TTXJTVSBRDZWHL-RMOCHZDMSA-N |
| XLogP | 3.02 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|