C18H18F3N3O3 — CID 3924032
N-[(4-butoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 3924032) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(4-butoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3924032 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[(4-butoxyphenyl)methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CCCCOc1ccc(C=NNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-2-3-10-27-15-7-4-13(5-8-15)12-22-23-16-9-6-14(18(19,20)21)11-17(16)24(25)26/h4-9,11-12,23H,2-3,10H2,1H3 |
| InChIKey | PBKASLRFOVWYQQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|