C18H17ClF3N3O3 — CID 126082313
N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126082313) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126082313 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-chlorophenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CC[C@H](C)Oc1ccc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H17ClF3N3O3/c1-3-11(2)28-17-7-4-12(8-14(17)19)10-23-24-15-6-5-13(18(20,21)22)9-16(15)25(26)27/h4-11,24H,3H2,1-2H3/b23-10-/t11-/m0/s1 |
| InChIKey | ZFLFACFPQRJSEX-ASDNRQTRSA-N |
| XLogP | 5.89 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|