C21H14F3N5O8 — CID 126111745
N-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 126111745) has the molecular formula C21H14F3N5O8 and a molecular weight of 521.36 g/mol. Its IUPAC name is N-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126111745 |
| Molecular Formula | C21H14F3N5O8 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | N-[(Z)-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1cc(/C=N\Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H14F3N5O8/c1-36-20-8-12(11-25-26-15-5-3-13(21(22,23)24)9-16(15)28(32)33)2-6-19(20)37-18-7-4-14(27(30)31)10-17(18)29(34)35/h2-11,26H,1H3/b25-11- |
| InChIKey | NHNRBQFEQGRVRM-GATIEOLUSA-N |
| XLogP | 5.68 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|