C23H19F3N2O4 — CID 126216857
N-(4-ethylphenyl)-1-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine (PubChem CID 126216857) has the molecular formula C23H19F3N2O4 and a molecular weight of 444.41 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine.
| Compound Name | N-(4-ethylphenyl)-1-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126216857 |
| Molecular Formula | C23H19F3N2O4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(4-ethylphenyl)-1-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
| SMILES | CCc1ccc(/N=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C23H19F3N2O4/c1-3-15-4-8-18(9-5-15)27-14-16-6-10-21(22(12-16)31-2)32-20-11-7-17(23(24,25)26)13-19(20)28(29)30/h4-14H,3H2,1-2H3/b27-14+ |
| InChIKey | GBQNWHJZINTBGY-MZJWZYIUSA-N |
| XLogP | 6.73 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|