C22H16ClF3N2O3 — CID 126216100
1-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethylphenyl)methanimine (PubChem CID 126216100) has the molecular formula C22H16ClF3N2O3 and a molecular weight of 448.83 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 126216100 |
| Molecular Formula | C22H16ClF3N2O3 |
| Molecular Weight | 448.83 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-[3-chloro-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/N=C/c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H16ClF3N2O3/c1-2-14-3-7-17(8-4-14)27-13-15-5-9-20(18(23)11-15)31-21-10-6-16(22(24,25)26)12-19(21)28(29)30/h3-13H,2H2,1H3/b27-13+ |
| InChIKey | GSAKDSRMKLSNTA-UVHMKAGCSA-N |
| XLogP | 7.37 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.83 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|