C22H15F3IN3O6 — CID 126089119
1-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-nitrophenyl)methanimine (PubChem CID 126089119) has the molecular formula C22H15F3IN3O6 and a molecular weight of 601.28 g/mol. Its IUPAC name is 1-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-nitrophenyl)methanimine.
| Compound Name | 1-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 126089119 |
| Molecular Formula | C22H15F3IN3O6 |
| Molecular Weight | 601.28 g/mol |
| Exact Mass | 601.00 |
| IUPAC Name | 1-[3-ethoxy-5-iodo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(4-nitrophenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc([N+](=O)[O-])cc2)cc(I)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15F3IN3O6/c1-2-34-20-10-13(12-27-15-4-6-16(7-5-15)28(30)31)9-17(26)21(20)35-19-8-3-14(22(23,24)25)11-18(19)29(32)33/h3-12H,2H2,1H3/b27-12+ |
| InChIKey | RAWIPMLVICBRCI-KKMKTNMSSA-N |
| XLogP | 7.07 |
| TPSA | 117.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.28 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|