C26H18IN3O7 — CID 126206396
1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine (PubChem CID 126206396) has the molecular formula C26H18IN3O7 and a molecular weight of 611.35 g/mol. Its IUPAC name is 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine.
| Compound Name | 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126206396 |
| Molecular Formula | C26H18IN3O7 |
| Molecular Weight | 611.35 g/mol |
| Exact Mass | 611.02 |
| IUPAC Name | 1-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-N-(4-phenoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(I)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H18IN3O7/c1-35-25-14-17(16-28-18-7-10-21(11-8-18)36-20-5-3-2-4-6-20)13-22(27)26(25)37-24-12-9-19(29(31)32)15-23(24)30(33)34/h2-16H,1H3/b28-16+ |
| InChIKey | HIFFJKGTDGQSDY-LQKURTRISA-N |
| XLogP | 7.45 |
| TPSA | 126.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.35 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|