C21H16ClN3O6 — CID 126218866
1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(2-methylphenyl)methanimine (PubChem CID 126218866) has the molecular formula C21H16ClN3O6 and a molecular weight of 441.83 g/mol. Its IUPAC name is 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(2-methylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126218866 |
| Molecular Formula | C21H16ClN3O6 |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(2-methylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccccc2C)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16ClN3O6/c1-13-5-3-4-6-17(13)23-12-14-9-16(22)21(20(10-14)30-2)31-19-8-7-15(24(26)27)11-18(19)25(28)29/h3-12H,1-2H3/b23-12+ |
| InChIKey | RKGFBUHHRKBCRN-FSJBWODESA-N |
| XLogP | 6.02 |
| TPSA | 117.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|