C21H15Cl2N3O6 — CID 126220358
1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chloro-2-methylphenyl)methanimine (PubChem CID 126220358) has the molecular formula C21H15Cl2N3O6 and a molecular weight of 476.27 g/mol. Its IUPAC name is 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126220358 |
| Molecular Formula | C21H15Cl2N3O6 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 1-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chloro-2-methylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(Cl)c2C)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H15Cl2N3O6/c1-12-15(22)4-3-5-17(12)24-11-13-8-16(23)21(20(9-13)31-2)32-19-7-6-14(25(27)28)10-18(19)26(29)30/h3-11H,1-2H3/b24-11+ |
| InChIKey | RKPVDKMECWVDNY-BHGWPJFGSA-N |
| XLogP | 6.67 |
| TPSA | 117.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|