C22H15BrClF3N2O4 — CID 126222669
1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine (PubChem CID 126222669) has the molecular formula C22H15BrClF3N2O4 and a molecular weight of 543.72 g/mol. Its IUPAC name is 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126222669 |
| Molecular Formula | C22H15BrClF3N2O4 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 1-[3-bromo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-2-methylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(Cl)c2C)cc(Br)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15BrClF3N2O4/c1-12-16(24)4-3-5-17(12)28-11-13-8-15(23)21(20(9-13)32-2)33-19-7-6-14(22(25,26)27)10-18(19)29(30)31/h3-11H,1-2H3/b28-11+ |
| InChIKey | LKPRHHQOFFBYSA-IPBVOBEMSA-N |
| XLogP | 7.89 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|