C22H15Br2F3N2O3 — CID 126221185
1-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126221185) has the molecular formula C22H15Br2F3N2O3 and a molecular weight of 572.18 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126221185 |
| Molecular Formula | C22H15Br2F3N2O3 |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 569.94 |
| IUPAC Name | 1-[3,5-dibromo-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C\c2cc(Br)cc(Br)c2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H15Br2F3N2O3/c1-12-3-5-17(7-13(12)2)28-11-14-8-16(23)10-18(24)21(14)32-20-6-4-15(22(25,26)27)9-19(20)29(30)31/h3-11H,1-2H3/b28-11- |
| InChIKey | YZGGRMJKUKEZCF-FXMZOFOKSA-N |
| XLogP | 8.30 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|