C21H16BrN3O5 — CID 126217525
1-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126217525) has the molecular formula C21H16BrN3O5 and a molecular weight of 470.28 g/mol. Its IUPAC name is 1-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126217525 |
| Molecular Formula | C21H16BrN3O5 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 1-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)cc1C |
| InChI | InChI=1S/C21H16BrN3O5/c1-13-3-5-16(9-14(13)2)23-12-15-4-7-20(18(22)10-15)30-21-8-6-17(24(26)27)11-19(21)25(28)29/h3-12H,1-2H3/b23-12+ |
| InChIKey | MVSZIGCNOGIXRZ-FSJBWODESA-N |
| XLogP | 6.43 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|