C21H15Br2N3O5 — CID 126215177
1-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126215177) has the molecular formula C21H15Br2N3O5 and a molecular weight of 549.18 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126215177 |
| Molecular Formula | C21H15Br2N3O5 |
| Molecular Weight | 549.18 g/mol |
| Exact Mass | 546.94 |
| IUPAC Name | 1-[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc(Br)cc(Br)c2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H15Br2N3O5/c1-12-3-4-16(7-13(12)2)24-11-14-8-15(22)9-18(23)21(14)31-20-6-5-17(25(27)28)10-19(20)26(29)30/h3-11H,1-2H3/b24-11+ |
| InChIKey | BEXGYHQLHCKZGV-BHGWPJFGSA-N |
| XLogP | 7.19 |
| TPSA | 107.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.18 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|