C13H7Br2N3O6 — CID 124671284
(NZ)-N-[[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylidene]hydroxylamine (PubChem CID 124671284) has the molecular formula C13H7Br2N3O6 and a molecular weight of 461.02 g/mol. Its IUPAC name is (NZ)-N-[[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 124671284 |
| Molecular Formula | C13H7Br2N3O6 |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 458.87 |
| IUPAC Name | (NZ)-N-[[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]methylidene]hydroxylamine |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(Br)cc(/C=N\O)cc2Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7Br2N3O6/c14-9-3-7(6-16-19)4-10(15)13(9)24-12-2-1-8(17(20)21)5-11(12)18(22)23/h1-6,19H/b16-6- |
| InChIKey | YCGREBOHPCVCBU-SOFYXZRVSA-N |
| XLogP | 4.63 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|