C22H11Br2N5O8 — CID 126092281
(E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126092281) has the molecular formula C22H11Br2N5O8 and a molecular weight of 633.17 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126092281 |
| Molecular Formula | C22H11Br2N5O8 |
| Molecular Weight | 633.17 g/mol |
| Exact Mass | 630.90 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)c(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(Br)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H11Br2N5O8/c23-17-7-12(6-13(11-25)22(30)26-14-2-1-3-15(9-14)27(31)32)8-18(24)21(17)37-20-5-4-16(28(33)34)10-19(20)29(35)36/h1-10H,(H,26,30)/b13-6+ |
| InChIKey | TZFYZEOAIYEIIM-AWNIVKPZSA-N |
| XLogP | 6.27 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.17 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|