C23H14ClN5O9 — CID 126092221
(E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126092221) has the molecular formula C23H14ClN5O9 and a molecular weight of 539.84 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126092221 |
| Molecular Formula | C23H14ClN5O9 |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14ClN5O9/c1-37-21-9-13(7-14(12-25)23(30)26-15-3-2-4-16(10-15)27(31)32)8-18(24)22(21)38-20-6-5-17(28(33)34)11-19(20)29(35)36/h2-11H,1H3,(H,26,30)/b14-7+ |
| InChIKey | OSCBTVZMLJULKH-VGOFMYFVSA-N |
| XLogP | 5.41 |
| TPSA | 200.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|