C25H19BrN4O7 — CID 3624457
3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 3624457) has the molecular formula C25H19BrN4O7 and a molecular weight of 567.35 g/mol. Its IUPAC name is 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3624457 |
| Molecular Formula | C25H19BrN4O7 |
| Molecular Weight | 567.35 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-2-cyano-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)C(C#N)=Cc2cc(Br)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C25H19BrN4O7/c1-3-15-4-6-18(7-5-15)28-25(31)17(14-27)10-16-11-20(26)24(23(12-16)36-2)37-22-9-8-19(29(32)33)13-21(22)30(34)35/h4-13H,3H2,1-2H3,(H,28,31) |
| InChIKey | VSHDFFGFCDBFDD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.35 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|