C24H16Br2N4O6 — CID 126087190
(E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 126087190) has the molecular formula C24H16Br2N4O6 and a molecular weight of 616.22 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126087190 |
| Molecular Formula | C24H16Br2N4O6 |
| Molecular Weight | 616.22 g/mol |
| Exact Mass | 613.94 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-(2,4-dinitrophenoxy)phenyl]-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C/c2cc(Br)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)c1C |
| InChI | InChI=1S/C24H16Br2N4O6/c1-13-4-3-5-20(14(13)2)28-24(31)16(12-27)8-15-9-18(25)23(19(26)10-15)36-22-7-6-17(29(32)33)11-21(22)30(34)35/h3-11H,1-2H3,(H,28,31)/b16-8+ |
| InChIKey | NVNJJARIVRQNPO-LZYBPNLTSA-N |
| XLogP | 6.98 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.22 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|