C24H14Br2F3N3O4 — CID 126095033
(E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 126095033) has the molecular formula C24H14Br2F3N3O4 and a molecular weight of 625.20 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126095033 |
| Molecular Formula | C24H14Br2F3N3O4 |
| Molecular Weight | 625.20 g/mol |
| Exact Mass | 622.93 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dibromo-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C/c1cc(Br)c(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C24H14Br2F3N3O4/c1-13-4-2-3-5-19(13)31-23(33)15(12-30)8-14-9-17(25)22(18(26)10-14)36-21-7-6-16(24(27,28)29)11-20(21)32(34)35/h2-11H,1H3,(H,31,33)/b15-8+ |
| InChIKey | XHTWWAJVFGBRCD-OVCLIPMQSA-N |
| XLogP | 7.78 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.20 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|