C29H24F3N3O5 — CID 126097667
(E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enamide (PubChem CID 126097667) has the molecular formula C29H24F3N3O5 and a molecular weight of 551.52 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126097667 |
| Molecular Formula | C29H24F3N3O5 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]-5-prop-2-enylphenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc(C)c2C)cc(OC)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24F3N3O5/c1-5-7-20-12-19(13-21(16-33)28(36)34-23-9-6-8-17(2)18(23)3)14-26(39-4)27(20)40-25-11-10-22(29(30,31)32)15-24(25)35(37)38/h5-6,8-15H,1,7H2,2-4H3,(H,34,36)/b21-13+ |
| InChIKey | PIEPTOMIQWEVCJ-FYJGNVAPSA-N |
| XLogP | 7.31 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|