C26H19N5O9 — CID 124526259
(E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 124526259) has the molecular formula C26H19N5O9 and a molecular weight of 545.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124526259 |
| Molecular Formula | C26H19N5O9 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | (E)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19N5O9/c1-3-5-17-10-16(11-18(15-27)26(32)28-19-6-4-7-20(13-19)29(33)34)12-24(39-2)25(17)40-23-9-8-21(30(35)36)14-22(23)31(37)38/h3-4,6-14H,1,5H2,2H3,(H,28,32)/b18-11+ |
| InChIKey | UYCRRORWSVHUQO-WOJGMQOQSA-N |
| XLogP | 5.49 |
| TPSA | 200.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|