C27H23N3O7S — CID 126069281
[4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126069281) has the molecular formula C27H23N3O7S and a molecular weight of 533.56 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126069281 |
| Molecular Formula | C27H23N3O7S |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | [4-[(E)-2-cyano-3-(3-nitroanilino)-3-oxoprop-1-enyl]-2-methoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H23N3O7S/c1-4-6-20-13-19(14-21(17-28)27(31)29-22-7-5-8-23(16-22)30(32)33)15-25(36-3)26(20)37-38(34,35)24-11-9-18(2)10-12-24/h4-5,7-16H,1,6H2,2-3H3,(H,29,31)/b21-14+ |
| InChIKey | CMOGVNNHDFYXQR-KGENOOAVSA-N |
| XLogP | 4.95 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|