C29H28N2O6S — CID 126078497
[4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126078497) has the molecular formula C29H28N2O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126078497 |
| Molecular Formula | C29H28N2O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | [4-[(E)-2-cyano-3-(4-methoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(OC)cc2)cc(OCC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H28N2O6S/c1-5-7-22-16-21(17-23(19-30)29(32)31-24-10-12-25(35-4)13-11-24)18-27(36-6-2)28(22)37-38(33,34)26-14-8-20(3)9-15-26/h5,8-18H,1,6-7H2,2-4H3,(H,31,32)/b23-17+ |
| InChIKey | IHPSMROVZUFGTD-HAVVHWLPSA-N |
| XLogP | 5.44 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|