C24H23ClN2O3 — CID 126073079
(E)-N-(4-chlorophenyl)-2-cyano-3-(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)prop-2-enamide (PubChem CID 126073079) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-2-cyano-3-(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126073079 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-2-cyano-3-(3-ethoxy-4-prop-2-enoxy-5-prop-2-enylphenyl)prop-2-enamide |
| SMILES | C=CCOc1c(CC=C)cc(/C=C(\C#N)C(=O)Nc2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C24H23ClN2O3/c1-4-7-18-13-17(15-22(29-6-3)23(18)30-12-5-2)14-19(16-26)24(28)27-21-10-8-20(25)9-11-21/h4-5,8-11,13-15H,1-2,6-7,12H2,3H3,(H,27,28)/b19-14+ |
| InChIKey | NTPPUCREQOQKTJ-XMHGGMMESA-N |
| XLogP | 5.58 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|