C31H30N2O6 — CID 126081107
4-[[4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126081107) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is 4-[[4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126081107 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 4-[[4-[(E)-2-cyano-3-(4-ethoxyanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(OCC)cc2)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H30N2O6/c1-4-7-24-16-22(17-25(19-32)30(34)33-26-12-14-27(15-13-26)37-5-2)18-28(38-6-3)29(24)39-20-21-8-10-23(11-9-21)31(35)36/h4,8-18H,1,5-7,20H2,2-3H3,(H,33,34)(H,35,36)/b25-17+ |
| InChIKey | REQIJTOUMFLEJO-KOEQRZSOSA-N |
| XLogP | 6.04 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|