C28H25ClN2O3 — CID 126082494
(E)-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 126082494) has the molecular formula C28H25ClN2O3 and a molecular weight of 472.97 g/mol. Its IUPAC name is (E)-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126082494 |
| Molecular Formula | C28H25ClN2O3 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (E)-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccccc2)cc(OCC)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H25ClN2O3/c1-3-9-22-14-21(15-23(18-30)28(32)31-25-12-6-5-7-13-25)17-26(33-4-2)27(22)34-19-20-10-8-11-24(29)16-20/h3,5-8,10-17H,1,4,9,19H2,2H3,(H,31,32)/b23-15+ |
| InChIKey | YDRDLDHBVGQOPB-HZHRSRAPSA-N |
| XLogP | 6.59 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|