C29H25FN2O5 — CID 126078716
4-[[4-[(E)-2-cyano-3-(4-fluoroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126078716) has the molecular formula C29H25FN2O5 and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-[[4-[(E)-2-cyano-3-(4-fluoroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-2-cyano-3-(4-fluoroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126078716 |
| Molecular Formula | C29H25FN2O5 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 4-[[4-[(E)-2-cyano-3-(4-fluoroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(/C=C(\C#N)C(=O)Nc2ccc(F)cc2)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H25FN2O5/c1-3-5-22-14-20(15-23(17-31)28(33)32-25-12-10-24(30)11-13-25)16-26(36-4-2)27(22)37-18-19-6-8-21(9-7-19)29(34)35/h3,6-16H,1,4-5,18H2,2H3,(H,32,33)(H,34,35)/b23-15+ |
| InChIKey | JRXJSZREIFJDKR-HZHRSRAPSA-N |
| XLogP | 5.78 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|