C25H19Cl3N2O3 — CID 126048382
(E)-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126048382) has the molecular formula C25H19Cl3N2O3 and a molecular weight of 501.80 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126048382 |
| Molecular Formula | C25H19Cl3N2O3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | (E)-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(Cl)c(OCc3cccc(Cl)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H19Cl3N2O3/c1-2-32-21-8-6-20(7-9-21)30-25(31)18(14-29)10-17-12-22(27)24(23(28)13-17)33-15-16-4-3-5-19(26)11-16/h3-13H,2,15H2,1H3,(H,30,31)/b18-10+ |
| InChIKey | LLIVCZYZPYTRKO-VCHYOVAHSA-N |
| XLogP | 7.17 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|