C24H17Cl3N2O2 — CID 126064588
(E)-N-benzyl-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 126064588) has the molecular formula C24H17Cl3N2O2 and a molecular weight of 471.77 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126064588 |
| Molecular Formula | C24H17Cl3N2O2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)c(OCc2cccc(Cl)c2)c(Cl)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H17Cl3N2O2/c25-20-8-4-7-17(10-20)15-31-23-21(26)11-18(12-22(23)27)9-19(13-28)24(30)29-14-16-5-2-1-3-6-16/h1-12H,14-15H2,(H,29,30)/b19-9+ |
| InChIKey | SBUGESNWDXPLQG-DJKKODMXSA-N |
| XLogP | 6.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|