C27H23ClN2O5 — CID 5042885
4-[[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 5042885) has the molecular formula C27H23ClN2O5 and a molecular weight of 490.94 g/mol. Its IUPAC name is 4-[[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 5042885 |
| Molecular Formula | C27H23ClN2O5 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 4-[[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=C(C#N)C(=O)NCc2ccccc2)cc(Cl)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H23ClN2O5/c1-2-34-24-14-20(12-22(15-29)26(31)30-16-18-6-4-3-5-7-18)13-23(28)25(24)35-17-19-8-10-21(11-9-19)27(32)33/h3-14H,2,16-17H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | CDFVQDPXAUASER-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|