C19H14Cl2N2O4 — CID 1268969
2-[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2,6-dichlorophenoxy]acetic acid (PubChem CID 1268969) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is 2-[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2,6-dichlorophenoxy]acetic acid.
| Compound Name | 2-[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2,6-dichlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 1268969 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[4-[3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]-2,6-dichlorophenoxy]acetic acid |
| SMILES | N#CC(=Cc1cc(Cl)c(OCC(=O)O)c(Cl)c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c20-15-7-13(8-16(21)18(15)27-11-17(24)25)6-14(9-22)19(26)23-10-12-4-2-1-3-5-12/h1-8H,10-11H2,(H,23,26)(H,24,25) |
| InChIKey | DWCCERJGJKUWIS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|